Introduction：Basic information about CAS 611-89-2|2-Propenoic acid,2,3-dibromo-3-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propenoic acid,2,3-dibromo-3-phenyl- |
|---|
| CAS Number | 611-89-2 | Molecular Weight | 305.95100 |
|---|
| Density | 1.979g/cm3 | Boiling Point | 335.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Br2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.9ºC |
|---|
Names
| Name | α,β-dibromo-cinnamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.979g/cm3 |
|---|
| Boiling Point | 335.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Br2O2 |
|---|
| Molecular Weight | 305.95100 |
|---|
| Flash Point | 156.9ºC |
|---|
| Exact Mass | 303.87300 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.22960 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | YCUQJKHDFXAMBE-FPLPWBNLSA-N |
|---|
| SMILES | O=C(O)C(Br)=C(Br)c1ccccc1 |
|---|
Synonyms
| ,-dibromo-cinnamic acid |
| .-Dibrom--phenyl-acrylsaeure |
| ,-Dibrom-zimtsaeure |
