Introduction：Basic information about CAS 1608-46-4|1,2-Diiodo-4-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Diiodo-4-nitrobenzene |
|---|
| CAS Number | 1608-46-4 | Molecular Weight | 374.902 |
|---|
| Density | 2.6±0.1 g/cm3 | Boiling Point | 347.6±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3I2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.0±25.1 °C |
|---|
Names
| Name | 1,2-diiodo-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.6±0.1 g/cm3 |
|---|
| Boiling Point | 347.6±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3I2NO2 |
|---|
| Molecular Weight | 374.902 |
|---|
| Flash Point | 164.0±25.1 °C |
|---|
| Exact Mass | 374.825287 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.87 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.739 |
|---|
| InChIKey | FBLUCIWMGHTPJO-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(I)c(I)c1 |
|---|
Synonyms
| 4-Nitro-1,2-diiodobenzene |
| 1,2-Diiodo-4-nitrobenzene |
| 1,2-diiodo-4-nitro-benzene |
| 3,4-diiodonitrobenzene |
| 1,2-Dijod-4-nitro-benzol |
| Benzene, 1,2-diiodo-4-nitro- |
| 1,2-Diiod-4-nitro-benzol |
| Benzene,1,2-diiodo-4-nitro |
