Introduction：Basic information about CAS 39193-06-1|4, 4-Dichlorobenzanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4, 4-Dichlorobenzanilide |
|---|
| CAS Number | 39193-06-1 | Molecular Weight | 266.12300 |
|---|
| Density | 1.384g/cm3 | Boiling Point | 316.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9Cl2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.2ºC |
|---|
Names
| Name | 4-chloro-N-(4-chlorophenyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.384g/cm3 |
|---|
| Boiling Point | 316.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9Cl2NO |
|---|
| Molecular Weight | 266.12300 |
|---|
| Flash Point | 145.2ºC |
|---|
| Exact Mass | 265.00600 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 4.31870 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | WXARQXZZFOCDNR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|---|
Synonyms
| 4-Chlor-benzoesaeure-(4-chlor-anilid) |
| N-(p-chlorophenyl)-p-chlorobenzamide |
| 4-chloro-N-(4-chlorophenyl)-benzamid |
| N-(p-Chlorobenzoyl)-p-chloraniline |
| 4,4'-Dichlorobenzanilide |
| 4-chloro-benzoic acid-(4-chloro-anilide) |
| n1-(4-chlorophenyl)-4-chlorobenzamide |
| Benzamide,4-chloro-N-(4-chlorophenyl) |
