Introduction：Basic information about CAS 135-52-4|zincon, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | zincon |
|---|
| CAS Number | 135-52-4 | Molecular Weight | 440.429 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C20H16N4O6S | Melting Point | 203ºC (dec.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2-(-2-((-(2-Hydroxy-5-sulfophenyl)diazenyl)-(phenyl)methylene)hydrazinyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 203ºC (dec.) |
|---|
| Molecular Formula | C20H16N4O6S |
|---|
| Molecular Weight | 440.429 |
|---|
| Exact Mass | 440.079041 |
|---|
| PSA | 169.39000 |
|---|
| LogP | 3.16 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | OWQUYBAASOSGNO-CDNKMLFNSA-N |
|---|
| SMILES | O=C(O)c1ccccc1N=NC(=NNc1cc(S(=O)(=O)O)ccc1O)c1ccccc1 |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39-36 |
|---|
| HS Code | 2928000090 |
|---|
Customs
| HS Code | 2928000090 |
|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-(-2-((-(2-Hydroxy-5-sulfophenyl)diazenyl)(phenyl)methylene)hydrazinyl)benzoic acid |
| 2-CARBOXY-2'-HYDROXY-5'-SULFOFORMAZYLBENZENE |
| Zincon sodium salt hydrate |
| EINECS 205-197-9 |
| Zincon hydrate sodium salt |
| Benzoic acid, 2-[(2E)-2-[[(E)-2-(2-hydroxy-5-sulfophenyl)diazenyl]phenylmethylene]hydrazinyl]- |
| 2-[(2E)-2-{[(E)-(2-Hydroxy-5-sulfophenyl)diazenyl](phenyl)methylene}hydrazino]benzoic acid |
| MFCD00007507 |
| ZinconGr |
| 2-Carboxy-2'-hydroxy-5'-sulfo-formazylbenzol |
| Zincon,for the photometric determination of copper and zinc |
