Introduction：Basic information about CAS 130144-34-2|7-Ethyl-10-hydroxycamptothecin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Ethyl-10-hydroxycamptothecin |
|---|
| CAS Number | 130144-34-2 | Molecular Weight | 392.405 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 810.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H20N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 443.8±34.3 °C |
|---|
Names
| Name | 7-Ethyl-10-hydroxycamptothecin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 810.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H20N2O5 |
|---|
| Molecular Weight | 392.405 |
|---|
| Flash Point | 443.8±34.3 °C |
|---|
| Exact Mass | 392.137207 |
|---|
| PSA | 101.65000 |
|---|
| LogP | 2.31 |
|---|
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.738 |
|---|
| InChIKey | FJHBVJOVLFPMQE-UHFFFAOYSA-N |
|---|
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
|---|
Synonyms
| 1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 4,11-diethyl-4,9-dihydroxy- |
| 4,11-Diethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| 7-Ethyl-10-hydroxy-camptothecin |
| 7-Ethyl-10-hydroxycamptothecin |
| SN-387 lactone |
| Captothecin,7-ethyl-10-hydroxy |
| SN 38 lactone |
| SN 38 |
