Introduction：Basic information about CAS 13139-27-0|Cbz-Ala-NH2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cbz-Ala-NH2 |
|---|
| CAS Number | 13139-27-0 | Molecular Weight | 222.24000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H14N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | z-ala-nh2 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H14N2O3 |
|---|
| Molecular Weight | 222.24000 |
|---|
| Exact Mass | 222.10000 |
|---|
| PSA | 81.42000 |
|---|
| LogP | 1.87780 |
|---|
| InChIKey | CTZZSWNVVFTJRN-QMMMGPOBSA-N |
|---|
| SMILES | CC(NC(=O)OCc1ccccc1)C(N)=O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Cbz-Ala-NH2 |
| Z-Ala-Phe-OH |
| N-Cbz-L-Ala-L-PheOH |
| CBz-L-alanine |
| N-Cbz-L-Ala amide |
| N-benzyloxycarbonyl-L-alanyl-L-phenylalanine |
| Cbz-L-Ala-NH2 |
| Cbz-L-Ala-L-Phe-OH |
