Introduction:Basic information about CAS 13139-52-1|ZD-Gln-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZD-Gln-OH |
|---|
| CAS Number | 13139-52-1 | Molecular Weight | 280.276 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 604.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O5 | Melting Point | 138-142ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 319.2±31.5 °C |
|---|
Names
| Name | (2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 604.2±55.0 °C at 760 mmHg |
|---|
| Melting Point | 138-142ºC |
|---|
| Molecular Formula | C13H16N2O5 |
|---|
| Molecular Weight | 280.276 |
|---|
| Flash Point | 319.2±31.5 °C |
|---|
| Exact Mass | 280.105927 |
|---|
| PSA | 118.72000 |
|---|
| LogP | 0.72 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | JIMLDJNLXLMGLX-SNVBAGLBSA-N |
|---|
| SMILES | NC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Glutamine, N-[(phenylmethoxy)carbonyl]- |
| N-A-CBZ-D-GLN |
| N-CBZ-D-glutamine |
| N-carbobenzoxy-D-glutamine |
| N-[(Benzyloxy)carbonyl]glutamine |
| N-[(Benzyloxy)carbonyl]-D-glutamine |
| Cbz-D-glutamine |
| N-Benzyloxycarbonyl-D-glutamine |
| Z-D-Gln-OH |
| AmbotzZAA1203 |
| Z-D-glutamine |
| MFCD00065698 |
| D-Glutamine, N-[(phenylmethoxy)carbonyl]- |
| Benzyloxycarbonyl-D-glutamin |
| Cbz-D-Gln-OH |