Introduction：Basic information about CAS 13189-00-9|Zinc methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zinc methacrylate |
|---|
| CAS Number | 13189-00-9 | Molecular Weight | 235.54300 |
|---|
| Density | 1.4 g/cm3 | Boiling Point | 160.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H10O4Zn | Melting Point | 229-232ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07, GHS08 | Signal Word | Danger |
|---|
Names
| Name | zinc,2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4 g/cm3 |
|---|
| Boiling Point | 160.5ºC at 760 mmHg |
|---|
| Melting Point | 229-232ºC |
|---|
| Molecular Formula | C8H10O4Zn |
|---|
| Molecular Weight | 235.54300 |
|---|
| Exact Mass | 233.98700 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.13750 |
|---|
| Vapour Pressure | 1.23mmHg at 25°C |
|---|
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
|---|
| SMILES | C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].[Zn+2] |
|---|
Safety Information
| Symbol |
GHS07, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H319-H334-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38;R43 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Methacrylic acid,zinc salt |
| EINECS 236-144-8 |
| Zinc methacrylate |
| Zinc dimethacrylate |
| MFCD00045887 |
