Introduction：Basic information about CAS 16642-79-8|3-(4-Nitrophenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-Nitrophenyl)propanoic acid |
|---|
| CAS Number | 16642-79-8 | Molecular Weight | 195.172 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 382.7±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | 167-170°C |
|---|
| MSDS | USA | Flash Point | 170.5±9.4 °C |
|---|
Names
| Name | 3-(4-Nitrophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 382.7±17.0 °C at 760 mmHg |
|---|
| Melting Point | 167-170°C |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.172 |
|---|
| Flash Point | 170.5±9.4 °C |
|---|
| Exact Mass | 195.053162 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 1.57 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | VZOPVJNBOQOLPN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-(4-Nitrophenyl)propionic acid |
| Benzenepropanoic acid, 4-nitro- |
| 4-Nitrohydrocinnamic Acid |
| 4-nitrobenzenepropanoic acid |
| WNR D2VQ |
| 4-nitrophenylpropionic acid |
| MFCD00126834 |
| para-nitrohydrocinnamic acid |
| 3-(4-Nitrophenyl)propanoic acid |
