Introduction：Basic information about CAS 1655-56-7|L-Isoleucine,N-(2,4-dinitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-Isoleucine,N-(2,4-dinitrophenyl)- |
|---|
| CAS Number | 1655-56-7 | Molecular Weight | 297.26400 |
|---|
| Density | 1.412g/cm3 | Boiling Point | 509.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H15N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 262.1ºC |
|---|
Names
| Name | dnp-l-isoleucine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.412g/cm3 |
|---|
| Boiling Point | 509.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H15N3O6 |
|---|
| Molecular Weight | 297.26400 |
|---|
| Flash Point | 262.1ºC |
|---|
| Exact Mass | 297.09600 |
|---|
| PSA | 140.97000 |
|---|
| LogP | 3.53360 |
|---|
| Vapour Pressure | 3.27E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | PCZSORDQCDENOD-QRIDDKLISA-N |
|---|
| SMILES | CCC(C)C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
Synonyms
| DNP-L-Isoleucine 2,4-Dinitrophenyl-L-isoleucine |
| DNP-Isoleucine |
| N-(2,4-Dinitrophenyl)isoleucine |
| N-(2,4-dinitro-phenyl)-L-isoleucine |
| N-(2,4-Dinitro-phenyl)-L-isoleucin |
| L-Isoleucine,N-(2,4-dinitrophenyl) |
| 2,4-dinitrophenyl-L-isoleucine |
| N-2-4-dnp-L-isoleucine crystalline |
