Introduction：Basic information about CAS 1679-75-0|Cinnamaverine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cinnamaverine |
|---|
| CAS Number | 1679-75-0 | Molecular Weight | 323.42900 |
|---|
| Density | 1.069g/cm3 | Boiling Point | 447.7ºC at 760mmHg |
|---|
| Molecular Formula | C21H25NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140.7ºC |
|---|
Names
| Name | 2-(diethylamino)ethyl (E)-2,3-diphenylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.069g/cm3 |
|---|
| Boiling Point | 447.7ºC at 760mmHg |
|---|
| Molecular Formula | C21H25NO2 |
|---|
| Molecular Weight | 323.42900 |
|---|
| Flash Point | 140.7ºC |
|---|
| Exact Mass | 323.18900 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 4.11220 |
|---|
| Vapour Pressure | 3.28E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | UTTZVFFEPWFVRY-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOC(=O)C(=Cc1ccccc1)c1ccccc1 |
|---|
Synonyms
| 2-diethylaminoethyl (E)-2,3-diphenylprop-2-enoate |
| 2-Diethylaminoethyl 2-phenylcinnamat |
| 2-Diethylaminoethyl 2,3-diphenylacrylate |
| Cinnamaverine |
| UNII-M7R15X2683 |
| Cinnamaverina |
| CB 2136 |
