Introduction:Basic information about CAS 635-10-9|tetramethyl pyromellitate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetramethyl pyromellitate |
|---|
| CAS Number | 635-10-9 | Molecular Weight | 310.25600 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 370.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O8 | Melting Point | 143-144°C |
|---|
| MSDS | / | Flash Point | 161.5ºC |
|---|
Names
| Name | tetramethyl benzene-1,2,4,5-tetracarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 370.9ºC at 760 mmHg |
|---|
| Melting Point | 143-144°C |
|---|
| Molecular Formula | C14H14O8 |
|---|
| Molecular Weight | 310.25600 |
|---|
| Flash Point | 161.5ºC |
|---|
| Exact Mass | 310.06900 |
|---|
| PSA | 105.20000 |
|---|
| LogP | 0.83300 |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | QVEIFJBUBJUUMB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(=O)OC)c(C(=O)OC)cc1C(=O)OC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | UT7140900 |
|---|
| HS Code | 29333999 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Pyromellitic acid tetramethyl ester |
| Tetramethyl pyromellitate |
| 1,2,4,5-tetramethoxycarbonylbenzene |
| 1,2,4,5-Benzenetetracarboxylic acid,tetramethyl ester |
| MFCD00014903 |
| tetramethyl-1,2,4,5-benzene tetracarboxylate |
| EINECS 211-226-6 |
| 1,2,4,5,-tetracarbomethoxybenzene |