Introduction:Basic information about CAS 133-11-9|fenamisal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fenamisal |
|---|
| CAS Number | 133-11-9 | Molecular Weight | 229.231 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 406.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3 | Melting Point | 150-152 °C(lit.) |
|---|
| MSDS | / | Flash Point | 199.6±24.6 °C |
|---|
Names
| Name | Phenyl-4-aminosalicylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 406.4±30.0 °C at 760 mmHg |
|---|
| Melting Point | 150-152 °C(lit.) |
|---|
| Molecular Formula | C13H11NO3 |
|---|
| Molecular Weight | 229.231 |
|---|
| Flash Point | 199.6±24.6 °C |
|---|
| Exact Mass | 229.073898 |
|---|
| PSA | 72.55000 |
|---|
| LogP | 2.95 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | DNVVZWSVACQWJE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(=O)Oc2ccccc2)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922509090 |
|---|
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Phenyl-PAS-Tebamin |
| phenyl 4-aminosalicylate |
| Tebanyl |
| Phenyl-4-aminosalicy |
| EINECS 205-092-8 |
| fenamisal |
| Phenyl aminosalicylate |
| Pheny-Pas-Tebamin |
| 4-Amino-2-hydroxy-benzoesaeure-phenylester |
| Phenyl p-Aminosalicylic Acid |
| phenyl-p-aminosalicylate |
| MFCD00007788 |
| p-Aminosalol |
| Tebamin |
| Phenyl PAS |
| 4-amino-2-hydroxy-benzoic acid phenyl ester |
| Salicylic acid, 4-amino-, phenyl ester (8CI) |
| 4-amino-2-hydroxybenzoic acid phenyl ester |
| Benzoic acid, 4-amino-2-hydroxy-, phenyl ester |
| UNII-52936SIP7V |
| p-Aminosalicylic Acid Phenyl Ester |
| Phenyl 4-amino-2-hydroxybenzoate |