Introduction：Basic information about CAS 25265-17-2|3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine,formaldehyde,phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine,formaldehyde,phenol |
|---|
| CAS Number | 25265-17-2 | Molecular Weight | 294.43200 |
|---|
| Density | / | Boiling Point | 217.2ºC at 760mmHg |
|---|
| Molecular Formula | C17H30N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 98.7ºC |
|---|
Names
| Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine,formaldehyde,phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 217.2ºC at 760mmHg |
|---|
| Molecular Formula | C17H30N2O2 |
|---|
| Molecular Weight | 294.43200 |
|---|
| Flash Point | 98.7ºC |
|---|
| Exact Mass | 294.23100 |
|---|
| PSA | 89.34000 |
|---|
| LogP | 4.73260 |
|---|
| Vapour Pressure | 0.135mmHg at 25°C |
|---|
| InChIKey | UPIIQJYVOQBGDC-UHFFFAOYSA-N |
|---|
| SMILES | C=O.CC1(C)CC(N)CC(C)(CN)C1.Oc1ccccc1 |
|---|
Synonyms
| 3-(aminomethyl)-3,5,5-trimethyl-cyclohexan-1-amine |
| Formaldehyde,polymer with 5-amino-1,3,3-trimethylcyclohexanemethanamine and phenol |
| Isophoronediamine,phenol,formaldehyde polymer |
