Introduction：Basic information about CAS 139962-97-3|4-Benzyloxy-2-formylphenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Benzyloxy-2-formylphenylboronic acid |
|---|
| CAS Number | 139962-97-3 | Molecular Weight | 256.062 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 490.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H13BO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.3±31.5 °C |
|---|
Names
| Name | (4-(Benzyloxy)-2-formylphenyl)boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 490.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H13BO4 |
|---|
| Molecular Weight | 256.062 |
|---|
| Flash Point | 250.3±31.5 °C |
|---|
| Exact Mass | 256.090698 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.67 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | XRARNEIDTRHXKN-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cc(OCc2ccccc2)ccc1B(O)O |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| 4-Benzyloxy-2-formylphenylboronic acid |
| MFCD02179486 |
| [4-(Benzyloxy)-2-formylphenyl]boronic acid |
| Boronic acid, B-[2-formyl-4-(phenylmethoxy)phenyl]- |
| 4-benzyloxy-2-formylphenyl boronic acid |
