Introduction：Basic information about CAS 1655-35-2|Sodium naphthalene-2,7-disulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium naphthalene-2,7-disulfonate |
|---|
| CAS Number | 1655-35-2 | Molecular Weight | 332.261 |
|---|
| Density | 1.704g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H6Na2O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,7-Naphthalenedisulfonic Acid Disodium Salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.704g/cm3 |
|---|
| Molecular Formula | C10H6Na2O6S2 |
|---|
| Molecular Weight | 332.261 |
|---|
| Exact Mass | 331.940125 |
|---|
| PSA | 131.16000 |
|---|
| LogP | 2.80960 |
|---|
| InChIKey | XOIWXJSPLXGSLZ-UHFFFAOYSA-L |
|---|
| SMILES | O=S(=O)([O-])c1ccc2ccc(S(=O)(=O)[O-])cc2c1.[Na+].[Na+] |
|---|
Safety Information
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00066365 |
| 2,7-Naphthylene disulfonic acid Na salt |
| Ebert-Merz α-Acid Disodium Salt |
| Disodium 2,7-naphthalenedisulfonate |
| Sodium naphthalene-2,7-disulfonate |
| EINECS 216-733-6 |
| 2,7-Naphthalenedisulfonic acid disodium salt |
| 2,7-Naphthalenedisulfonic acid, disodium salt |
| 2,7-Naphthalenedisulfonic acid, sodium salt (1:2) |
| disodium naphthalene-2,7-disulfonate |
