Introduction：Basic information about CAS 611-92-7|N,N'-Dimethylcarbanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-Dimethylcarbanilide |
|---|
| CAS Number | 611-92-7 | Molecular Weight | 240.300 |
|---|
| Density | 1.161±0.06 g/cm3 | Boiling Point | 350.0±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H16N2O | Melting Point | 120-122 °C(lit.) |
|---|
| MSDS | / | Flash Point | 142.6±11.6 °C |
|---|
Names
| Name | 1,3-dimethyl-1,3-diphenylurea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.161±0.06 g/cm3 |
|---|
| Boiling Point | 350.0±11.0 °C at 760 mmHg |
|---|
| Melting Point | 120-122 °C(lit.) |
|---|
| Molecular Formula | C15H16N2O |
|---|
| Molecular Weight | 240.300 |
|---|
| Flash Point | 142.6±11.6 °C |
|---|
| Exact Mass | 240.126266 |
|---|
| PSA | 23.55000 |
|---|
| LogP | 2.52 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | ADCBKYIHQQCFHE-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=O)N(C)c1ccccc1)c1ccccc1 |
|---|
| Water Solubility | Very slightly soluble (0.13 g/L) (25 ºC) |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | FE0600000 |
|---|
Synonyms
| N,N'-dimethyl-N,N'-diphenyl-urea |
| N,N'-Dimethyl-N,N'-diphenyl-harnstoff |
| Methyl centralite |
| N,N'-Dimethylcarbanilide |
| Centralite II |
| N,N`-dimethyl-N,N`-diphenylurea |
| Urea, N,N'-dimethyl-N,N'-diphenyl- |
| di-(methylphenyl)urea |
| Carbanilide,N,N'-dimethyl |
| 1,3-Dimethyl-1,3-diphenylurea |
| Centralit II |
| N.N'-Dimethyl-carbanilid |
| MFCD00025642 |
| EINECS 210-283-4 |
| Urea,N,N'-dimethyl-N,N'-diphenyl |
| Centralite-2 |
