Introduction:Basic information about CAS 13721-01-2|1,4-Dihydro-4-oxoquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Dihydro-4-oxoquinoline-3-carboxylic acid |
|---|
| CAS Number | 13721-01-2 | Molecular Weight | 189.167 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 384.7±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7NO3 | Melting Point | 269-270℃ |
|---|
| MSDS | / | Flash Point | 186.5±25.1 °C |
|---|
Names
| Name | 4-Oxo-1,4-dihydroquinoline-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 384.7±32.0 °C at 760 mmHg |
|---|
| Melting Point | 269-270℃ |
|---|
| Molecular Formula | C10H7NO3 |
|---|
| Molecular Weight | 189.167 |
|---|
| Flash Point | 186.5±25.1 °C |
|---|
| Exact Mass | 189.042587 |
|---|
| PSA | 70.16000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.730 |
|---|
| InChIKey | ILNJBIQQAIIMEY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c[nH]c2ccccc2c1=O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 22 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Hydroxyquinoline-3-carboxylic acid |
| 4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| 1,4-Dihydro-4-oxoquinoline-3-carboxylic acid |
| 1,4-Dihydro-4-oxo-quinoline-3-carboxylic acid |
| 4-Hydroxy-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 4-hydroxy- |