Introduction：Basic information about CAS 133408-50-1|metominostrobin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | metominostrobin |
|---|
| CAS Number | 133408-50-1 | Molecular Weight | 284.310 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H16N2O3 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
Names
| Name | metominostrobin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Molecular Formula | C16H16N2O3 |
|---|
| Molecular Weight | 284.310 |
|---|
| Exact Mass | 284.116089 |
|---|
| PSA | 59.92000 |
|---|
| LogP | 4.39 |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | HIIRDDUVRXCDBN-SDXDJHTJSA-N |
|---|
| SMILES | CNC(=O)C(=NOC)c1ccccc1Oc1ccccc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Metominofen |
| ssf-126 |
| (E)-2-(methoxyimino)-N-methyl-2-(2-phenoxyphenyl)acetamide |
| (αE)-α-(methoxyimino)-N-methyl-2-phenoxybenzeneacetamide |
| (E)-2-Methoxyimino-N-methyl-2-(2-phenoxyphenyl)acetamide |
| metaminostrobin |
| (2E)-2-(Methoxyimino)-N-methyl-2-(2-phenoxyphenyl)acetamide |
| (E)-a-(Methoxyimino)-N-methyl-2-phenoxybenzeneacetamide |
| metominostrobin |
| Benzeneacetamide, α-(methoxyimino)-N-methyl-2-phenoxy-, (αE)- |
| (E)-METOMINOSTROBIN |
