Introduction：Basic information about CAS 61925-90-4|2,3,5,6-tetrachlorophenol acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-tetrachlorophenol acetate |
|---|
| CAS Number | 61925-90-4 | Molecular Weight | 273.92800 |
|---|
| Density | 1.566g/cm3 | Boiling Point | 340.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.9ºC |
|---|
Names
| Name | 2,3,5,6-tetrachlorophenol acetate |
|---|
Chemical & Physical Properties
| Density | 1.566g/cm3 |
|---|
| Boiling Point | 340.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl4O2 |
|---|
| Molecular Weight | 273.92800 |
|---|
| Flash Point | 145.9ºC |
|---|
| Exact Mass | 271.89700 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.22550 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | NHBOZDKIYJWIIT-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1c(Cl)c(Cl)cc(Cl)c1Cl |
|---|
