Introduction:Basic information about CAS 3939-01-3|Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride |
|---|
| CAS Number | 3939-01-3 | Molecular Weight | 283.751 |
|---|
| Density | / | Boiling Point | 366ºC at 760mmHg |
|---|
| Molecular Formula | C14H18ClNO3 | Melting Point | 185 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 175.2ºC |
|---|
Names
| Name | Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 366ºC at 760mmHg |
|---|
| Melting Point | 185 °C (dec.)(lit.) |
|---|
| Molecular Formula | C14H18ClNO3 |
|---|
| Molecular Weight | 283.751 |
|---|
| Flash Point | 175.2ºC |
|---|
| Exact Mass | 283.097534 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.99050 |
|---|
| InChIKey | BRADBAOVPACOQQ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1CN(Cc2ccccc2)CCC1=O.Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Methyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1) |
| Methyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride (1:1) |
| EINECS 223-522-2 |
| MFCD00012799 |
| 1-Benzyl-4-oxo-3-piperidinecarboxylic Acid Methyl Ester Hydrochloride |
| 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, methyl ester, hydrochloride (1:1) |
| Methyl 1-Benzyl-4-oxo-3-piperidinecarboxylate Hydrochloride |
| 1-Benzyl-3-methoxycarbonyl-4-piperidone Hydrochloride |
| methyl 1-benzyl-4-oxopiperidine-3-carboxylate,hydrochloride |
| methyl-1-benzyl-4-oxopiperidin-3-carboxylathydrochlorid |
| Methyl 1-benzyl-4-oxo-3-piperidine-carboxylate hydrochloride |
| Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride |