Introduction：Basic information about CAS 139679-45-1|1-(4-fluorobenzoyl)piperidine-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-fluorobenzoyl)piperidine-4-carboxylic acid |
|---|
| CAS Number | 139679-45-1 | Molecular Weight | 251.25400 |
|---|
| Density | 1.315g/cm3 | Boiling Point | 450.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.5ºC |
|---|
Names
| Name | 1-(4-fluorobenzoyl)piperidine-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.315g/cm3 |
|---|
| Boiling Point | 450.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14FNO3 |
|---|
| Molecular Weight | 251.25400 |
|---|
| Flash Point | 226.5ºC |
|---|
| Exact Mass | 251.09600 |
|---|
| PSA | 57.61000 |
|---|
| LogP | 1.70040 |
|---|
| Vapour Pressure | 6.44E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | NOBBVBPNOXXVPA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
|---|
Safety Information
