Introduction：Basic information about CAS 61857-83-8|2,2-Dimethyl-4,6-dioxo-5-thienyl-1,3-dioxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Dimethyl-4,6-dioxo-5-thienyl-1,3-dioxane |
|---|
| CAS Number | 61857-83-8 | Molecular Weight | 226.24900 |
|---|
| Density | 1.303 g/cm3 | Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10O4S | Melting Point | 130ºC |
|---|
| MSDS | / | Flash Point | 235.3ºC |
|---|
Names
| Name | 2,2-dimethyl-5-thiophen-3-yl-1,3-dioxane-4,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303 g/cm3 |
|---|
| Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Melting Point | 130ºC |
|---|
| Molecular Formula | C10H10O4S |
|---|
| Molecular Weight | 226.24900 |
|---|
| Flash Point | 235.3ºC |
|---|
| Exact Mass | 226.03000 |
|---|
| PSA | 80.84000 |
|---|
| LogP | 1.66780 |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | HAGWJJFKVFSZLP-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC(=O)C(c2ccsc2)C(=O)O1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-(Thienyl)meldrum's Acid |
| 2,2-Dimethyl-5-thiophen-3-yl-[1,3]d |
| 2,2-dimethyl-5-thiophen-3-yl-[1,3]dioxane-4,6-dione |
| 2,2-dimethyl-5-(thien-3-yl)-1,3-dioxane-4,6-dione |
| 2,2-Dimethyl-5-(3-thienyl)-1,3-dioxane-4,6-dione |
| 2,2-Dimethyl-5-(3-thienyl)-4,6-diketo-1,3-dioxan |
| ioxane-4,6-dione |
