Introduction：Basic information about CAS 167306-96-9|4-(trans-4-pentylcyclohexyl)-1-fluorobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trans-4-pentylcyclohexyl)-1-fluorobenzene |
|---|
| CAS Number | 167306-96-9 | Molecular Weight | 263.32600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H19F2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(trans-4-pentylcyclohexyl)-1-fluorobenzene |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H19F2N |
|---|
| Molecular Weight | 263.32600 |
|---|
| Exact Mass | 263.14900 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 4.91038 |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | KTBIKJACWUFHMI-UHFFFAOYSA-N |
|---|
| SMILES | CCCC1CCC(c2cc(F)c(C#N)c(F)c2)CC1 |
|---|
