Introduction：Basic information about CAS 1664-57-9|3-(3-Nitrophenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-Nitrophenyl)propanoic acid |
|---|
| CAS Number | 1664-57-9 | Molecular Weight | 195.172 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 379.4±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | 110-112°C |
|---|
| MSDS | / | Flash Point | 168.9±9.4 °C |
|---|
Names
| Name | 3-(3-Nitrophenyl)propionic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 379.4±17.0 °C at 760 mmHg |
|---|
| Melting Point | 110-112°C |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.172 |
|---|
| Flash Point | 168.9±9.4 °C |
|---|
| Exact Mass | 195.053162 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 1.57 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | ZOANOABZUNJOJT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCc1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Nitrohydrocinnamic acid |
| Benzenepropanoic acid, 3-nitro- |
| WNR C2VQ |
| MFCD01310835 |
| 3-(3-Nitrophenyl)propionic acid |
| 3-Nitrobenzenepropanoic acid |
| 3-(3-Nitrophenyl)propanoic acid |
