Introduction：Basic information about CAS 133025-23-7|Way100135, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Way100135 |
|---|
| CAS Number | 133025-23-7 | Molecular Weight | 468.46000 |
|---|
| Density | 1.085g/cm3 | Boiling Point | 582.8ºC at 760mmHg |
|---|
| Molecular Formula | C24H35Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.3ºC |
|---|
Names
| Name | N-tert-butyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylpropanamide |
|---|
Chemical & Physical Properties
| Density | 1.085g/cm3 |
|---|
| Boiling Point | 582.8ºC at 760mmHg |
|---|
| Molecular Formula | C24H35Cl2N3O2 |
|---|
| Molecular Weight | 468.46000 |
|---|
| Flash Point | 306.3ºC |
|---|
| Exact Mass | 467.21100 |
|---|
| PSA | 44.81000 |
|---|
| LogP | 5.51350 |
|---|
| Vapour Pressure | 1.43E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | UMTDAKAAYOXIKU-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1N1CCN(CC(C(=O)NC(C)(C)C)c2ccccc2)CC1 |
|---|
