Introduction:Basic information about CAS 330-14-3|4-(Trifluoromethylthio)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Trifluoromethylthio)benzoyl chloride |
|---|
| CAS Number | 330-14-3 | Molecular Weight | 240.630 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 200.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4ClF3OS | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 75.1±27.3 °C |
|---|
| Symbol | GHS02, GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-(trifluoromethylsulfanyl)benzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 200.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4ClF3OS |
|---|
| Molecular Weight | 240.630 |
|---|
| Flash Point | 75.1±27.3 °C |
|---|
| Exact Mass | 239.962341 |
|---|
| PSA | 42.37000 |
|---|
| LogP | 3.92 |
|---|
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | BCMFTOCCLOAGBP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc(SC(F)(F)F)cc1 |
|---|
Safety Information
| Symbol | GHS02, GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H226-H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R10;R34 |
|---|
| Safety Phrases | S16-S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-(Trifluoromethylthio)benzoyl chloride |
| 4-((Trifluoromethyl)thio)benzoyl chloride |
| 4-[(Trifluormethyl)sulfanyl]benzolcarbonylchlorid |
| 4-trifluoromethylsulfanyl-benzoyl chloride |
| Benzoyl chloride, 4-[(trifluoromethyl)thio]- |
| GVR DSXFFF |
| MFCD01631632 |
| 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride |
| 4-Trifluormethylmercapto-benzoylchlorid |