Introduction：Basic information about CAS 135591-00-3|mefenpyr, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | mefenpyr |
|---|
| CAS Number | 135591-00-3 | Molecular Weight | 317.12500 |
|---|
| Density | 1.61 g/cm3 | Boiling Point | 533.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10Cl2N2O4 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
Names
| Name | mefenpyr |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61 g/cm3 |
|---|
| Boiling Point | 533.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10Cl2N2O4 |
|---|
| Molecular Weight | 317.12500 |
|---|
| Exact Mass | 316.00200 |
|---|
| PSA | 90.20000 |
|---|
| LogP | 1.98800 |
|---|
| Vapour Pressure | 3.34E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | XEJNEDVTJPXRSM-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C(=O)O)CC(C(=O)O)=NN1c1ccc(Cl)cc1Cl |
|---|
Synonyms
| Mefenpyr |
| rac-(5R)-1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylic acid |
| 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylic acid |
| (RS)-1-(2,4-dichlorophenyl)-5-methyl-2-pyrazoline-3,5-dicarboxylic acid |
| 1-(2,4-dichlorophenyl)-4,5-dihydro-5-methyl-1H-pyrazole-3,5-dicarboxylic acid |
