Introduction：Basic information about CAS 367508-01-8|Diphenyl (N-Methoxy-N-methylcarbamoylmethyl)phosphonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diphenyl (N-Methoxy-N-methylcarbamoylmethyl)phosphonate |
|---|
| CAS Number | 367508-01-8 | Molecular Weight | 351.291 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 453.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18NO6P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.8±26.5 °C |
|---|
Names
| Name | 2-diphenoxyphosphoryl-N-methoxy-N-methylacetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 453.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18NO6P |
|---|
| Molecular Weight | 351.291 |
|---|
| Flash Point | 227.8±26.5 °C |
|---|
| Exact Mass | 351.087158 |
|---|
| PSA | 84.11000 |
|---|
| LogP | 2.71 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | CFSFGLDTIDFDMT-UHFFFAOYSA-N |
|---|
| SMILES | CON(C)C(=O)CP(=O)(Oc1ccccc1)Oc1ccccc1 |
|---|
Synonyms
| N-Methoxy-N-methyl(diphenylphosphono)acetamide |
| (N-Methoxy-N-methylcarbamoylmethyl)phosphonic Acid Diphenyl Ester |
| Carbamic acid, N-methoxy-N-methyl-, (diphenoxyphosphinyl)methyl ester |
| D3709 |
| diethyl (N-methoxy-N-methylcarbamoylmethyl)phosphonate |
| N-methoxy-N-methyl-2-(diphenylphosphono)acetamide |
| Diphenyl ({[methoxy(methyl)carbamoyl]oxy}methyl)phosphonate |
| Diphenyl (N-Methoxy-N-methylcarbamoylmethyl)phosphonate |
