Introduction：Basic information about CAS 314730-65-9|2-Chloro-1,3-bis(2,6-diisopropylphenyl)-1,3,2-diazaphospholidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-1,3-bis(2,6-diisopropylphenyl)-1,3,2-diazaphospholidine |
|---|
| CAS Number | 314730-65-9 | Molecular Weight | 445.02000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C26H38ClN2P | Melting Point | 212-220ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaphospholidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 212-220ºC |
|---|
| Molecular Formula | C26H38ClN2P |
|---|
| Molecular Weight | 445.02000 |
|---|
| Exact Mass | 444.24600 |
|---|
| PSA | 20.07000 |
|---|
| LogP | 9.10250 |
|---|
| InChIKey | GOXQIZBBMCFUBH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1cccc(C(C)C)c1N1CCN(c2c(C(C)C)cccc2C(C)C)P1Cl |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1,3,2-Diazaphospholidine,1,3-bis[2,6-bis(1-methylethyl)phenyl]-2-chloro |
| 2-chloro-1,3-[di-(2,6-diisopropyl)phenyl]-1,3,2-diazaphospholidine |
| CH2CH2N2PCl(2,6-(iPr)2C6H3)2 |
| 2-Chloro-1,3-bis(2,6-diisopropylphenyl)[1,3,2]diazaphospholidine |
