Introduction：Basic information about CAS 3978-11-8|N-formylkynurenine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-formylkynurenine |
|---|
| CAS Number | 3978-11-8 | Molecular Weight | 236.224 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 563.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 294.5±30.1 °C |
|---|
Names
| Name | (2S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 563.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O4 |
|---|
| Molecular Weight | 236.224 |
|---|
| Flash Point | 294.5±30.1 °C |
|---|
| Exact Mass | 236.079712 |
|---|
| PSA | 109.49000 |
|---|
| LogP | 1.18 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | BYHJHXPTQMMKCA-QMMMGPOBSA-N |
|---|
| SMILES | NC(CC(=O)c1ccccc1NC=O)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| N-formylkynurenine |
| Benzenebutanoic acid, α-amino-2-(formylamino)-γ-oxo-, (αS)- |
| (S)-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| L-Formylkynurenine |
| N-Formyl-L-kynurenine |
| (2S)-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| 3-(2-formamidobenzoyl)-L-alanine |
