Introduction:Basic information about CAS 611-79-0|3,3'-Diaminobenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-Diaminobenzophenone |
|---|
| CAS Number | 611-79-0 | Molecular Weight | 212.247 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H12N2O | Melting Point | 150-151°C |
|---|
| MSDS | / | Flash Point | 237.7±24.6 °C |
|---|
Names
| Name | 3,3'-Diaminobenzophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 469.4±30.0 °C at 760 mmHg |
|---|
| Melting Point | 150-151°C |
|---|
| Molecular Formula | C13H12N2O |
|---|
| Molecular Weight | 212.247 |
|---|
| Flash Point | 237.7±24.6 °C |
|---|
| Exact Mass | 212.094955 |
|---|
| PSA | 69.11000 |
|---|
| LogP | 1.92 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | TUQQUUXMCKXGDI-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(C(=O)c2cccc(N)c2)c1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Methanone,bis(3-aminophenyl) |
| 3,3'-(Oxomethylene)bis(benzenamine) |
| bis(3-aminophenyl)-methanone |
| Methanone, bis(3-aminophenyl)- |
| MFCD00014774 |
| 3,3'-diamino-benzophenone |
| bis(3-azanylphenyl)methanone |
| 3.3'-Diamino-benzophenon |
| 3,3'-Diaminobenzophenone |
| Bis(3-aminophenyl)methanone |
| 3-aminophenyl-3-aminophenylketone |
| 3,3'-Carbonylbisaniline |
| EINECS 210-281-3 |