Introduction:Basic information about CAS 3137-56-2|4(1H)-Pyrimidinone,6-chloro-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4(1H)-Pyrimidinone,6-chloro-5-nitro- |
|---|
| CAS Number | 3137-56-2 | Molecular Weight | 175.53000 |
|---|
| Density | 1.95g/cm3 | Boiling Point | 212.5ºC at 760mmHg |
|---|
| Molecular Formula | C4H2ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 82.3ºC |
|---|
Names
| Name | 6-chloro-5-nitro-1H-pyrimidin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.95g/cm3 |
|---|
| Boiling Point | 212.5ºC at 760mmHg |
|---|
| Molecular Formula | C4H2ClN3O3 |
|---|
| Molecular Weight | 175.53000 |
|---|
| Flash Point | 82.3ºC |
|---|
| Exact Mass | 174.97800 |
|---|
| PSA | 91.57000 |
|---|
| LogP | 0.85470 |
|---|
| Index of Refraction | 1.725 |
|---|
| InChIKey | MXCCPRWUTGSJRR-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]cnc(Cl)c1[N+](=O)[O-] |
|---|
| Storage condition | 2-8℃ |
|---|
Synonyms
| 6-chloro-5-nitropyrimidin-4-ol |
| 4-Pyrimidinol,6-chloro-5-nitro |
| 6-chloro-5-nitro-3H-pyrimidin-4-one |