Introduction:Basic information about CAS 4735-49-3|1-[(E)-2-nitroethenyl]naphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(E)-2-nitroethenyl]naphthalene |
|---|
| CAS Number | 4735-49-3 | Molecular Weight | 199.20500 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 368.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 182.6ºC |
|---|
Names
| Name | 1-(2-nitroethenyl)naphthalene |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 368.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2 |
|---|
| Molecular Weight | 199.20500 |
|---|
| Flash Point | 182.6ºC |
|---|
| Exact Mass | 199.06300 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.61040 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | HNRGHIXNKWOUEO-CMDGGOBGSA-N |
|---|
| SMILES | O=[N+]([O-])C=Cc1cccc2ccccc12 |
|---|