Introduction:Basic information about CAS 137915-13-0|s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine |
|---|
| CAS Number | 137915-13-0 | Molecular Weight | 298.42400 |
|---|
| Density | 1.29 g/cm3 | Boiling Point | 479.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O2S2 | Melting Point | 224ºC-225ºC (dec.; lit.) |
|---|
| MSDS | / | Flash Point | 243.5ºC |
|---|
Names
| Name | (2R)-2-amino-3-(3-phenylpropylcarbamothioylsulfanyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29 g/cm3 |
|---|
| Boiling Point | 479.1ºC at 760 mmHg |
|---|
| Melting Point | 224ºC-225ºC (dec.; lit.) |
|---|
| Molecular Formula | C13H18N2O2S2 |
|---|
| Molecular Weight | 298.42400 |
|---|
| Flash Point | 243.5ºC |
|---|
| Exact Mass | 298.08100 |
|---|
| PSA | 132.74000 |
|---|
| LogP | 2.73000 |
|---|
| Vapour Pressure | 5.49E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | XMEUXBMTQJJHED-NSHDSACASA-N |
|---|
| SMILES | NC(CSC(=S)NCCCc1ccccc1)C(=O)O |
|---|
Synonyms
| L-Cysteine,(3-phenylpropyl)carbamodithioate (ester) (9CI) |
| S-(N-Phenylpropylthiocarbamoyl)cysteine |
| 2-AZIDO-1,3-DI-O-PIVALOYL-D-ERYTHRO-SPHINGOSINE |
| S-(N-(3-Phenylpropyl)(thiocarbamoyl))-cysteine |
| L-Cysteine,(3-phenylpropyl)carbamodithioate (ester) |
| Pptc-cysteine |
| S-<N-(3-phenylpropyl)(thiocarbamoyl)>-L-cysteine |