Introduction:Basic information about CAS 330-13-2|Phosphoric acid,mono(4-nitrophenyl) ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphoric acid,mono(4-nitrophenyl) ester |
|---|
| CAS Number | 330-13-2 | Molecular Weight | 461.35900 |
|---|
| Density | 1.712g/cm3 | Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H28N3O12P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.7ºC |
|---|
Names
| Name | 4-nitrophenyl phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.712g/cm3 |
|---|
| Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H28N3O12P |
|---|
| Molecular Weight | 461.35900 |
|---|
| Flash Point | 230.7ºC |
|---|
| Exact Mass | 461.14100 |
|---|
| PSA | 295.81000 |
|---|
| InChIKey | XZKIHKMTEMTJQX-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)O)cc1 |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2919900090 |
|---|
Customs
| HS Code | 2919900090 |
|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| 4-nitrophenyl hydrogen phosphate |
| (4-nitrophenyl) dihydrogen phosphate |
| 4-Nitrophenyl dihydrogen phosphate |
| 4-nitrophenyldihydrogen-phosphat |
| PNPP |
| Phosphoric acid,mono(4-nitrophenyl) ester |
| Nitrophenylphosphate |
| p-nitrophenyl dihydrogenphosphate |