Introduction:Basic information about CAS 13288-06-7|2-bromoethyl 4-nitrophenyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromoethyl 4-nitrophenyl ether |
|---|
| CAS Number | 13288-06-7 | Molecular Weight | 246.058 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 351.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8BrNO3 | Melting Point | 62-65ºC |
|---|
| MSDS | / | Flash Point | 166.2±22.3 °C |
|---|
Names
| Name | 1-(2-Bromoethoxy)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 351.2±22.0 °C at 760 mmHg |
|---|
| Melting Point | 62-65ºC |
|---|
| Molecular Formula | C8H8BrNO3 |
|---|
| Molecular Weight | 246.058 |
|---|
| Flash Point | 166.2±22.3 °C |
|---|
| Exact Mass | 244.968750 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.80 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | YQWCBDNNEZHPMA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OCCBr)cc1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-(2-bromoethyloxy)-4-nitro-benzene |
| 4-(2-bromoethoxy)-1-nitrobenzene |
| 2-(4-nitrophenoxy)ethyl bromide |
| 2-Bromoethyl 4-nitrophenyl ether |
| [(2-bromoethyl)oxy]-4-nitrobenzene 2-bromoethyl 4-nitrophenyl ether |
| 1-(2-Bromoethoxy)-4-nitrobenzene |
| 4-[2-bromoethoxy]nitrobenzene |
| p-(2-bromoethoxy)-nitrobenzene |
| β-Bromo-4-nitrophenetole |
| Benzene, 1-(2-bromoethoxy)-4-nitro- |
| 1-(4-nitrophenoxy)-2-bromoethane |
| 1-bromo-2-(4-nitrophenoxy)ethane |
| 2-Bromoethyl p-nitrophenyl ether |
| 2-bromoethyl 4-nitrophenylether |