Introduction:Basic information about CAS 58094-18-1|(+)-MOD-DIOP, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-MOD-DIOP |
|---|
| CAS Number | 58094-18-1 | Molecular Weight | 251.23500 |
|---|
| Density | 1.354g/cm3 | Boiling Point | 562ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO5 | Melting Point | 130-135ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 293.7ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (+)-n-benzoylglutamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.354g/cm3 |
|---|
| Boiling Point | 562ºC at 760 mmHg |
|---|
| Melting Point | 130-135ºC(lit.) |
|---|
| Molecular Formula | C12H13NO5 |
|---|
| Molecular Weight | 251.23500 |
|---|
| Flash Point | 293.7ºC |
|---|
| Exact Mass | 251.07900 |
|---|
| PSA | 103.70000 |
|---|
| LogP | 1.12530 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | LPJXPACOXRZCCP-SECBINFHSA-N |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1ccccc1)C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Benzoyl-DL-tyrosyl-di-n-propylamid |
| N-benzoyl-DL-glutamic acid |
| N-benzoyl-glutamic acid |
| N-Benzoyl-DL-glutaminsaeure |
| N-Benzoyl-DL-tyrosil-N',N'-dipropylamide |
| N-benzoyl-DL-tyrosil-di-n-propylamide |
| benzoylglutamic acid |
| DL-N-benzoylglutamic acid |
| MFCD00137636 |
| Benzoyl-dl-tyrosil-di-n-propylamide |
| Tiropramide Impurity C |