Introduction：Basic information about CAS 130561-48-7|Cintofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cintofen |
|---|
| CAS Number | 130561-48-7 | Molecular Weight | 374.77500 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 589.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H15ClN2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 310.3ºC |
|---|
Names
| Name | sintofen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 589.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H15ClN2O5 |
|---|
| Molecular Weight | 374.77500 |
|---|
| Flash Point | 310.3ºC |
|---|
| Exact Mass | 374.06700 |
|---|
| PSA | 90.65000 |
|---|
| LogP | 2.76250 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | QLMNCUHSDAGQGT-UHFFFAOYSA-N |
|---|
| SMILES | COCCOc1cccc2c1c(=O)c(C(=O)O)nn2-c1ccc(Cl)cc1 |
|---|
Synonyms
| 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxocinnoline-3-carboxylic acid |
| 1-(4'-chlorophenyl)-5-methoxyethoxy-1,4-dihydro-4-oxo-cinnoline-3-carboxylic acid |
| 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxo-3-cinnolinecarboxylic acid |
| cintofen |
| Cintofen |
| SC 2053 |
| CROISOR(R) 100 |
| 1-(4-chlorophenyl)-5-(2-methoxyethoxy)-4-oxocinnoline-3-carboxylic acid |
| 3-Cinnolinecarboxylicacid,1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxo |
| 1-(4-chlorophenyl)-5-(2-methoxyethoxy)-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid |
