Introduction：Basic information about CAS 132829-83-5|Espatropate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Espatropate |
|---|
| CAS Number | 132829-83-5 | Molecular Weight | 341.40400 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 569.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.1ºC |
|---|
Names
| Name | (3R)-1-Azabicyclo[2.2.2]oct-3-yl (2R)-3-hydroxy-2-(1H-imidazol-1- yl)-2-phenylpropanoate |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 569.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23N3O3 |
|---|
| Molecular Weight | 341.40400 |
|---|
| Flash Point | 298.1ºC |
|---|
| Exact Mass | 341.17400 |
|---|
| PSA | 67.59000 |
|---|
| LogP | 1.19430 |
|---|
| Vapour Pressure | 8.44E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | MDJOZYCYNUJABP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OC1CN2CCC1CC2)C(CO)(c1ccccc1)n1ccnc1 |
|---|
