Introduction：Basic information about CAS 361431-27-8|Myoseverin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Myoseverin B |
|---|
| CAS Number | 361431-27-8 | Molecular Weight | 472.58200 |
|---|
| Density | 1.278g/cm3 | Boiling Point | 714.814ºC at 760 mmHg |
|---|
| Molecular Formula | C27H32N6O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 386.106ºC |
|---|
Names
| Name | 9-cyclohexyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.278g/cm3 |
|---|
| Boiling Point | 714.814ºC at 760 mmHg |
|---|
| Molecular Formula | C27H32N6O2 |
|---|
| Molecular Weight | 472.58200 |
|---|
| Flash Point | 386.106ºC |
|---|
| Exact Mass | 472.25900 |
|---|
| PSA | 89.35000 |
|---|
| LogP | 5.06780 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | ZUZXYJOSNSTJMU-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CNc2nc(NCc3ccc(OC)cc3)c3ncn(C4CCCCC4)c3n2)cc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Myoseverin B |
| 2,6-Bis(4-methoxybenzylamino)-9-cyclohexylpurine |
