Introduction：Basic information about CAS 36519-00-3|phosdiphen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phosdiphen |
|---|
| CAS Number | 36519-00-3 | Molecular Weight | 416.02100 |
|---|
| Density | 1.503g/cm3 | Boiling Point | 447.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11Cl4O4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 364.7ºC |
|---|
Names
| Name | phosdiphen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.503g/cm3 |
|---|
| Boiling Point | 447.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11Cl4O4P |
|---|
| Molecular Weight | 416.02100 |
|---|
| Flash Point | 364.7ºC |
|---|
| Exact Mass | 413.91500 |
|---|
| PSA | 54.57000 |
|---|
| LogP | 6.90260 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | HEMINMLPKZELPP-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=O)(Oc1ccc(Cl)cc1Cl)Oc1ccc(Cl)cc1Cl |
|---|
Synonyms
| Phosdiphen |
| Phosdifen |
| Phosphoric acid,bis(2,4-dichlorophenyl) ethyl ester |
| EDP |
| Fosdifen [Czech] |
| Bis(2,4-dichlorophenyl) ethyl phosphate |
| bis(2,4-dichlorophenyl) ethyl phosphate |
| Fosdifen |
| bis(2,4-dichlorphenyl)-ethylphosphat |
| MTO-460 |
