Introduction：Basic information about CAS 25519-78-2|4-(4-Fluorobenzoyl)piperidinium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-Fluorobenzoyl)piperidinium chloride |
|---|
| CAS Number | 25519-78-2 | Molecular Weight | 243.705 |
|---|
| Density | 0.99g/cm3 | Boiling Point | 155ºC at 760mmHg |
|---|
| Molecular Formula | C12H15ClFNO | Melting Point | 222-224°C |
|---|
| MSDS | / | Flash Point | 23.9ºC |
|---|
Names
| Name | (4-fluorophenyl)-piperidin-4-ylmethanone,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.99g/cm3 |
|---|
| Boiling Point | 155ºC at 760mmHg |
|---|
| Melting Point | 222-224°C |
|---|
| Molecular Formula | C12H15ClFNO |
|---|
| Molecular Weight | 243.705 |
|---|
| Flash Point | 23.9ºC |
|---|
| Exact Mass | 243.082626 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.13880 |
|---|
| Vapour Pressure | 0.000266mmHg at 25°C |
|---|
| InChIKey | GPKDBZQZPNOBGM-UHFFFAOYSA-N |
|---|
| SMILES | Cl.O=C(c1ccc(F)cc1)C1CCNCC1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39-S22 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| (4-Fluorophenyl)(4-piperidinyl)methanone hydrochloride (1:1) |
| (4-FLUOROPHENYL)(4-PIPERIDYL)METHANONE HYDROCHLORIDE |
| Methanone, (4-fluorophenyl)-4-piperidinyl-, hydrochloride (1:1) |
| (4-Fluorophenyl)(piperidin-4-yl)methanone hydrochloride (1:1) |
| MFCD00044912 |
| (4-fluorophenyl)(piperidin-4-yl)methanone hydrochloride |
| 4-(4-Fluorobenzoyl)piperidinium chloride |
| 4-Fluorophenyl 4-piperidinyl ketone hydrochloride |
| EINECS 247-070-0 |
