Introduction:Basic information about CAS 31506-32-8|1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-methyloctane-1-sulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-methyloctane-1-sulfonamide |
|---|
| CAS Number | 31506-32-8 | Molecular Weight | 513.17100 |
|---|
| Density | 1.71g/cm3 | Boiling Point | 227.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H4F17NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 91.3ºC |
|---|
Names
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-methyloctane-1-sulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.71g/cm3 |
|---|
| Boiling Point | 227.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H4F17NO2S |
|---|
| Molecular Weight | 513.17100 |
|---|
| Flash Point | 91.3ºC |
|---|
| Exact Mass | 512.96900 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 5.97420 |
|---|
| Index of Refraction | 1.312 |
|---|
| InChIKey | SRMWNTGHXHOWBT-UHFFFAOYSA-N |
|---|
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Heptadecafluoro-N-methyl-1-octanesulfonamide |
| 1-Octanesulfonamide,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-methyl |
| EINECS 250-665-8 |
| N-methyl-perfluorooctane-1-sulfonamide |
| Heptadecafluoro-N-methyloctanesulphonamide |
| N-methylperfluorooctylsulphonamide |
| N-methyl-perfluorooctanesulfonamide |
| heptadecafluoro-N-methyloctanesulfonamide |
| n-C8F17SO2NHCH3 |