Introduction：Basic information about CAS 610-20-8|2,3-bis(nitrooxy)succinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-bis(nitrooxy)succinic acid |
|---|
| CAS Number | 610-20-8 | Molecular Weight | 240.08200 |
|---|
| Density | 1.954g/cm3 | Boiling Point | 350.1ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4N2O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.6ºC |
|---|
Names
| Name | 2,3-dinitrooxybutanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.954g/cm3 |
|---|
| Boiling Point | 350.1ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4N2O10 |
|---|
| Molecular Weight | 240.08200 |
|---|
| Flash Point | 165.6ºC |
|---|
| Exact Mass | 239.98700 |
|---|
| PSA | 184.70000 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | YIHNLKXIMXGECA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(O[N+](=O)[O-])C(O[N+](=O)[O-])C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,3-dinitrooxy-butanedioic acid |
| 2,3-Bis(nitrooxy)succinic acid |
| di-O-nitro-tartaric acid |
| 2,3-DIFLUORO-4-IODO-PHENYLACETALDEHYDE |
| EINECS 210-211-1 |
| tartaric acid dinitrate |
| Di-O-nitro-weinsaeure |
| Butanedioic acid,2,3-bis(nitrooxy) |
