Introduction:Basic information about CAS 61019-78-1|alpha-butyl-alpha-phenyl-1H-imidazole-1-propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | alpha-butyl-alpha-phenyl-1H-imidazole-1-propiononitrile |
|---|
| CAS Number | 61019-78-1 | Molecular Weight | 253.34200 |
|---|
| Density | 1.01g/cm3 | Boiling Point | 450.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.2ºC |
|---|
Names
| Name | fenapanil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01g/cm3 |
|---|
| Boiling Point | 450.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19N3 |
|---|
| Molecular Weight | 253.34200 |
|---|
| Flash Point | 226.2ºC |
|---|
| Exact Mass | 253.15800 |
|---|
| PSA | 41.61000 |
|---|
| LogP | 3.53488 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | OQOULEWDDRNBSG-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(C#N)(Cn1ccnc1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2933290012 |
|---|
| Summary | 2933290012 1-((2-chlorophenyl)diphenylmethyl)-1h-imidazole。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|---|
Synonyms
| α-butyl-α-phenyl-1H-imidazole-1-propanenitrile |
| Fenapanil |
| Sisthane |
| EINECS 262-560-4 |
| rac-(2R)-2-(1H-imidazol-1-ylmethyl)-2-phenylhexanenitrile |
| (RS)-2-(imidazol-1-ylmethyl)-2-phenylhexanenitrile |
| Fenapanil [ANSI] |
| RH-2161 |
| 2-(imidazol-1-ylmethyl)-2-phenylhexanenitrile |
| Caswell No. 131AA |