Introduction：Basic information about CAS 25231-47-4|di-tert-pentylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | di-tert-pentylphenol |
|---|
| CAS Number | 25231-47-4 | Molecular Weight | 234.37700 |
|---|
| Density | 0.921g/cm3 | Boiling Point | 315.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H26O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.1ºC |
|---|
Names
| Name | 2,3-bis(2-methylbutan-2-yl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.921g/cm3 |
|---|
| Boiling Point | 315.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H26O |
|---|
| Molecular Weight | 234.37700 |
|---|
| Flash Point | 147.1ºC |
|---|
| Exact Mass | 234.19800 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.76740 |
|---|
| Vapour Pressure | 0.000238mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | BRIRGRNYHFFFHD-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1cccc(O)c1C(C)(C)CC |
|---|
Synonyms
| Phenol,bis(1,1-dimethylpropyl) |
| Phenol,bis(1,1-dimethylpropyl)-(9CI) |
| Phenol,di-tert-pentyl-(6CI,7CI,8CI) |
| Di-tert-pentylphenol |
| Di-tert-amylphenol |
