Introduction：Basic information about CAS 25372-07-0|1-(4-imidazol-1-ylphenyl)imidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-imidazol-1-ylphenyl)imidazole |
|---|
| CAS Number | 25372-07-0 | Molecular Weight | 210.23500 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 419.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H10N4 | Melting Point | 216-217℃ |
|---|
| MSDS | / | Flash Point | 207.5ºC |
|---|
Names
| Name | 1-(4-imidazol-1-ylphenyl)imidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 419.4ºC at 760mmHg |
|---|
| Melting Point | 216-217℃ |
|---|
| Molecular Formula | C12H10N4 |
|---|
| Molecular Weight | 210.23500 |
|---|
| Flash Point | 207.5ºC |
|---|
| Exact Mass | 210.09100 |
|---|
| PSA | 35.64000 |
|---|
| LogP | 2.05800 |
|---|
| Vapour Pressure | 7.42E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | JWPDUQLIPMJLOF-UHFFFAOYSA-N |
|---|
| SMILES | c1cn(-c2ccc(-n3ccnc3)cc2)cn1 |
|---|
Synonyms
| 1-[4-(1H-imidazol-1-yl)phenyl]-1H-imidazole |
| 1,4-bis(imidazole-1-ylmethyl)benzene |
| 1,4-bis-(1H-imidazol-1-yl)benzene |
| 4,4'-bis(imidazol-1-yl)phenyl |
| 1,1'-(1,4-phenylene)bis-imidazole |
