Introduction：Basic information about CAS 160970-64-9|Silodosin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Silodosin |
|---|
| CAS Number | 160970-64-9 | Molecular Weight | 495.534 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 601.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H32F3N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.5±31.5 °C |
|---|
Names
| Name | 1-(3-Hydroxy-propyl)-5-(2(R)-{2-[2-(2,2,2-trifluoro-ethoxy)-phenoxy]-ethylamino}-propyl)-2,3-dihydro-1H-indol-7-carboxylic acid amide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 601.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H32F3N3O4 |
|---|
| Molecular Weight | 495.534 |
|---|
| Flash Point | 317.5±31.5 °C |
|---|
| Exact Mass | 495.234497 |
|---|
| PSA | 97.05000 |
|---|
| LogP | 2.52 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | PNCPYILNMDWPEY-UHFFFAOYSA-N |
|---|
| SMILES | CC(Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1ccccc1OCC(F)(F)F |
|---|
Synonyms
| 1-(3-Hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl}amino)propyl]-7-indolinecarboxamide |
| 1-(3-hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl}amino)propyl]-2,3-dihydro-1H-indole-7-carboxamide |
| rac-Silodosin |
| 1H-Indole-7-carboxamide, 2,3-dihydro-1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]- |
| Silodosin |
