Introduction：Basic information about CAS 168618-44-8|2-METHYL-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-METHYL-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID |
|---|
| CAS Number | 168618-44-8 | Molecular Weight | 212.24400 |
|---|
| Density | 1.156g/cm3 | Boiling Point | 381.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 175.5ºC |
|---|
Names
| Name | 3-(2-methylphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.156g/cm3 |
|---|
| Boiling Point | 381.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O2 |
|---|
| Molecular Weight | 212.24400 |
|---|
| Flash Point | 175.5ºC |
|---|
| Exact Mass | 212.08400 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.36020 |
|---|
| Vapour Pressure | 1.66E-06mmHg at 25°C |
|---|
| InChIKey | IAZJDWZUCUHVPQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1-c1cccc(C(=O)O)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-(2-tolyl)benzoic acid |
| 2'-METHYLACETANILIDE |
| AMTDA075 |
| 2'-methylbiphenyl-3-carboxylic acid |
| 2'-methyl[1,1'-biphenyl]-3-carboxylic acid |
